Ethyl 2-(1H-indol-2-yl)acetate
ethyl 2-indole acetate
CAS: 33588-64-6
Molecular Formula: C12H13NO2
Ethyl 2-(1H-indol-2-yl)acetate - Names and Identifiers
| Name | ethyl 2-indole acetate |
| Synonyms | Ethyl2-indoleacetate ethyl 2-indole acetate Ethyl Indole-2-Acetate ETHYL INDOLE-2-ACETATE ethyl 1H-indol-2-ylacetate Ethyl 2-(2-Indolyl)acetate ETHYL 1H-INDOL-2-YLACETATE Ethyl 2-(1H-indol-2-yl)acetate 2-(1-ethyl-1H-indol-2-yl)acetate Indol-2-ylacetic acid ethyl ester 1H-indole-2-acetic acid, ethyl ester 2-(1H-indol-2-yl)acetic acid ethyl ester |
| CAS | 33588-64-6 |
| EINECS | 1312995-182-4 |
| InChI | InChI=1/C12H13NO2/c1-2-15-12(14)8-10-7-9-5-3-4-6-11(9)13-10/h3-7,13H,2,8H2,1H3 |
Ethyl 2-(1H-indol-2-yl)acetate - Physico-chemical Properties
| Molecular Formula | C12H13NO2 |
| Molar Mass | 203.24 |
| Density | 1.187 |
| Melting Point | 28-31℃ |
| Boling Point | 118-120 °C(Press: 0.003 Torr) |
| Flash Point | 167.549°C |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 16.73±0.30(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.607 |
Ethyl 2-(1H-indol-2-yl)acetate - Introduction
ethyl 2-indole acetate is an organic compound with the chemical formula C12H13NO2, commonly abbreviated as EIA. The following is an introduction to the nature, use, formulation and safety information of ethyl 2-indole acetate:
Nature:
1. Appearance: ethyl 2-indole acetate is a colorless transparent liquid.
2. Solubility: It can be dissolved in many organic solvents, such as ethanol, acetone and dimethyl sulfoxide.
3. Density: The density of ethyl 2-indole acetate is about 1.09g/cm3.
4. Melting point and boiling point: its melting point and boiling point are about -10 ° C and 224 ° C respectively.
Use:
1. Synthesis: ethyl 2-indole acetate is commonly used as a synthetic intermediate, which can be used to synthesize indole compounds and has biological activities such as anti-cancer and anti-virus.
2. Spices: It is also used in the food and flavor and fragrance industries to add aroma to products.
Method:
ethyl 2-indole acetate can be prepared:
1. ethyl acetate reacts with indole to generate ethyl 2-indole acetate.
2. indole reacts with acid chloride to generate indolone, which then reacts with alcohol to obtain ethyl 2-indole acetate.
Safety Information:
1. ethyl 2-indole acetate is flammable and should avoid fire and high temperature.
2. Use should pay attention to protective measures, such as wearing gloves and goggles, avoid contact with skin, eyes and inhalation of its vapor.
3. Such as accidental contact, should immediately rinse with plenty of water, such as discomfort, should seek medical help.
4. Should be stored in a cool, dry place, away from the fire and oxidant.
Nature:
1. Appearance: ethyl 2-indole acetate is a colorless transparent liquid.
2. Solubility: It can be dissolved in many organic solvents, such as ethanol, acetone and dimethyl sulfoxide.
3. Density: The density of ethyl 2-indole acetate is about 1.09g/cm3.
4. Melting point and boiling point: its melting point and boiling point are about -10 ° C and 224 ° C respectively.
Use:
1. Synthesis: ethyl 2-indole acetate is commonly used as a synthetic intermediate, which can be used to synthesize indole compounds and has biological activities such as anti-cancer and anti-virus.
2. Spices: It is also used in the food and flavor and fragrance industries to add aroma to products.
Method:
ethyl 2-indole acetate can be prepared:
1. ethyl acetate reacts with indole to generate ethyl 2-indole acetate.
2. indole reacts with acid chloride to generate indolone, which then reacts with alcohol to obtain ethyl 2-indole acetate.
Safety Information:
1. ethyl 2-indole acetate is flammable and should avoid fire and high temperature.
2. Use should pay attention to protective measures, such as wearing gloves and goggles, avoid contact with skin, eyes and inhalation of its vapor.
3. Such as accidental contact, should immediately rinse with plenty of water, such as discomfort, should seek medical help.
4. Should be stored in a cool, dry place, away from the fire and oxidant.
Last Update：2024-04-09 15:17:56
Supplier List
Product Name: ETHYL INDOLE-2-ACETATE Visit Supplier Webpage Request for quotation
CAS: 33588-64-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 33588-64-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: ETHYL INDOLE-2-ACETATE Visit Supplier Webpage Request for quotation
CAS: 33588-64-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 33588-64-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History